C11H15NO — CID 131065584
2-(4-methyl-2,3-dihydroindol-1-yl)ethanol (PubChem CID 131065584) has the molecular formula C11H15NO and a molecular weight of 177.25 g/mol. Its IUPAC name is 2-(4-methyl-2,3-dihydroindol-1-yl)ethanol.
| Compound Name | 2-(4-methyl-2,3-dihydroindol-1-yl)ethanol |
|---|---|
| PubChem CID | 131065584 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | 2-(4-methyl-2,3-dihydroindol-1-yl)ethanol |
| SMILES | Cc1cccc2c1CCN2CCO |
| InChI | InChI=1S/C11H15NO/c1-9-3-2-4-11-10(9)5-6-12(11)7-8-13/h2-4,13H,5-8H2,1H3 |
| InChIKey | DKYGQSYBQIDRMO-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |