C22H20FN3O — CID 58992889
6-(4-fluorophenyl)-4-propan-2-yl-3,12,14-triazatricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaene-5-carbaldehyde (PubChem CID 58992889) has the molecular formula C22H20FN3O and a molecular weight of 361.42 g/mol. Its IUPAC name is 6-(4-fluorophenyl)-4-propan-2-yl-3,12,14-triazatricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaene-5-carbaldehyde.
| Compound Name | 6-(4-fluorophenyl)-4-propan-2-yl-3,12,14-triazatricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaene-5-carbaldehyde |
|---|---|
| PubChem CID | 58992889 |
| Molecular Formula | C22H20FN3O |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | 6-(4-fluorophenyl)-4-propan-2-yl-3,12,14-triazatricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaene-5-carbaldehyde |
| SMILES | CC(C)c1nc2c(c(-c3ccc(F)cc3)c1C=O)CCCc1ncncc1-2 |
| InChI | InChI=1S/C22H20FN3O/c1-13(2)21-18(11-27)20(14-6-8-15(23)9-7-14)16-4-3-5-19-17(22(16)26-21)10-24-12-25-19/h6-13H,3-5H2,1-2H3 |
| InChIKey | QSKRHOWPYWKKSB-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 55.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|