C24H22FNOS — CID 89099526
6-(4-fluorophenyl)-4-propan-2-yl-14-sulfanyl-3-azatricyclo[9.4.0.02,7]pentadeca-1(11),2,4,6,12,14-hexaene-5-carbaldehyde (PubChem CID 89099526) has the molecular formula C24H22FNOS and a molecular weight of 391.51 g/mol. Its IUPAC name is 6-(4-fluorophenyl)-4-propan-2-yl-14-sulfanyl-3-azatricyclo[9.4.0.02,7]pentadeca-1(11),2,4,6,12,14-hexaene-5-carbaldehyde.
| Compound Name | 6-(4-fluorophenyl)-4-propan-2-yl-14-sulfanyl-3-azatricyclo[9.4.0.02,7]pentadeca-1(11),2,4,6,12,14-hexaene-5-carbaldehyde |
|---|---|
| PubChem CID | 89099526 |
| Molecular Formula | C24H22FNOS |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 6-(4-fluorophenyl)-4-propan-2-yl-14-sulfanyl-3-azatricyclo[9.4.0.02,7]pentadeca-1(11),2,4,6,12,14-hexaene-5-carbaldehyde |
| SMILES | CC(C)c1nc2c(c(-c3ccc(F)cc3)c1C=O)CCCc1ccc(S)cc1-2 |
| InChI | InChI=1S/C24H22FNOS/c1-14(2)23-21(13-27)22(16-6-9-17(25)10-7-16)19-5-3-4-15-8-11-18(28)12-20(15)24(19)26-23/h6-14,28H,3-5H2,1-2H3 |
| InChIKey | VITYIBGHISMHGY-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 29.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|