C36H33FNOP — CID 21357575
5-(diphenylphosphorylmethyl)-6-(4-fluorophenyl)-4-propan-2-yl-3-azatricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaene (PubChem CID 21357575) has the molecular formula C36H33FNOP and a molecular weight of 545.64 g/mol. Its IUPAC name is 5-(diphenylphosphorylmethyl)-6-(4-fluorophenyl)-4-propan-2-yl-3-azatricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaene.
| Compound Name | 5-(diphenylphosphorylmethyl)-6-(4-fluorophenyl)-4-propan-2-yl-3-azatricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaene |
|---|---|
| PubChem CID | 21357575 |
| Molecular Formula | C36H33FNOP |
| Molecular Weight | 545.64 g/mol |
| Exact Mass | 545.23 |
| IUPAC Name | 5-(diphenylphosphorylmethyl)-6-(4-fluorophenyl)-4-propan-2-yl-3-azatricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaene |
| SMILES | CC(C)c1nc2c(c(-c3ccc(F)cc3)c1CP(=O)(c1ccccc1)c1ccccc1)CCCc1ccccc1-2 |
| InChI | InChI=1S/C36H33FNOP/c1-25(2)35-33(24-40(39,29-14-5-3-6-15-29)30-16-7-4-8-17-30)34(27-20-22-28(37)23-21-27)32-19-11-13-26-12-9-10-18-31(26)36(32)38-35/h3-10,12,14-18,20-23,25H,11,13,19,24H2,1-2H3 |
| InChIKey | GEYFFECPCSYUKX-UHFFFAOYSA-N |
| XLogP | 8.68 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.64 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|