C8H8N4 — CID 58429769
7-methylidene-8H-pyrido[4,3-d]pyrimidin-5-amine (PubChem CID 58429769) has the molecular formula C8H8N4 and a molecular weight of 160.18 g/mol. Its IUPAC name is 7-methylidene-8H-pyrido[4,3-d]pyrimidin-5-amine.
| Compound Name | 7-methylidene-8H-pyrido[4,3-d]pyrimidin-5-amine |
|---|---|
| PubChem CID | 58429769 |
| Molecular Formula | C8H8N4 |
| Molecular Weight | 160.18 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | 7-methylidene-8H-pyrido[4,3-d]pyrimidin-5-amine |
| SMILES | C=C1Cc2ncncc2C(N)=N1 |
| InChI | InChI=1S/C8H8N4/c1-5-2-7-6(8(9)12-5)3-10-4-11-7/h3-4H,1-2H2,(H2,9,12) |
| InChIKey | OBUFTYDOANPZRE-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 64.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.18 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |