C7H10N4S — CID 176729342
1,1-dimethyl-[1,3]thiazolo[4,5-d]pyrimidin-2-amine (PubChem CID 176729342) has the molecular formula C7H10N4S and a molecular weight of 182.25 g/mol. Its IUPAC name is 1,1-dimethyl-[1,3]thiazolo[4,5-d]pyrimidin-2-amine.
| Compound Name | 1,1-dimethyl-[1,3]thiazolo[4,5-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 176729342 |
| Molecular Formula | C7H10N4S |
| Molecular Weight | 182.25 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | 1,1-dimethyl-[1,3]thiazolo[4,5-d]pyrimidin-2-amine |
| SMILES | CS1(C)C(N)=Nc2ncncc21 |
| InChI | InChI=1S/C7H10N4S/c1-12(2)5-3-9-4-10-6(5)11-7(12)8/h3-4H,1-2H3,(H2,8,9,10,11) |
| InChIKey | ADBNUQHGMNKXAY-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 64.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.25 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |