C6H5N5 — CID 45080298
1H-pyrimido[4,5-f][1,3,5]triazepine (PubChem CID 45080298) has the molecular formula C6H5N5 and a molecular weight of 147.14 g/mol. Its IUPAC name is 1H-pyrimido[4,5-f][1,3,5]triazepine.
| Compound Name | 1H-pyrimido[4,5-f][1,3,5]triazepine |
|---|---|
| PubChem CID | 45080298 |
| Molecular Formula | C6H5N5 |
| Molecular Weight | 147.14 g/mol |
| Exact Mass | 147.05 |
| IUPAC Name | 1H-pyrimido[4,5-f][1,3,5]triazepine |
| SMILES | C1=NC=Nc2ncncc2N1 |
| InChI | InChI=1S/C6H5N5/c1-5-6(10-2-7-1)11-4-8-3-9-5/h1-4H,(H,7,8,9,10,11) |
| InChIKey | HOEYUETYUHVSII-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 62.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.14 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |