C11H8N4S — CID 11746378
6,11-dihydropyrimido[4,5-b][1,5]benzodiazepine-5-thione (PubChem CID 11746378) has the molecular formula C11H8N4S and a molecular weight of 228.28 g/mol. Its IUPAC name is 6,11-dihydropyrimido[4,5-b][1,5]benzodiazepine-5-thione.
| Compound Name | 6,11-dihydropyrimido[4,5-b][1,5]benzodiazepine-5-thione |
|---|---|
| PubChem CID | 11746378 |
| Molecular Formula | C11H8N4S |
| Molecular Weight | 228.28 g/mol |
| Exact Mass | 228.05 |
| IUPAC Name | 6,11-dihydropyrimido[4,5-b][1,5]benzodiazepine-5-thione |
| SMILES | S=C1Nc2ccccc2Nc2ncncc21 |
| InChI | InChI=1S/C11H8N4S/c16-11-7-5-12-6-13-10(7)14-8-3-1-2-4-9(8)15-11/h1-6H,(H,15,16)(H,12,13,14) |
| InChIKey | RUZRMNWFVSAFHE-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.28 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|