C12H10ClN3 — CID 121001280
9-chloro-6,11-dihydro-5H-pyrimido[4,5-b][1]benzazepine (PubChem CID 121001280) has the molecular formula C12H10ClN3 and a molecular weight of 231.69 g/mol. Its IUPAC name is 9-chloro-6,11-dihydro-5H-pyrimido[4,5-b][1]benzazepine.
| Compound Name | 9-chloro-6,11-dihydro-5H-pyrimido[4,5-b][1]benzazepine |
|---|---|
| PubChem CID | 121001280 |
| Molecular Formula | C12H10ClN3 |
| Molecular Weight | 231.69 g/mol |
| Exact Mass | 231.06 |
| IUPAC Name | 9-chloro-6,11-dihydro-5H-pyrimido[4,5-b][1]benzazepine |
| SMILES | Clc1ccc2c(c1)Nc1ncncc1CC2 |
| InChI | InChI=1S/C12H10ClN3/c13-10-4-3-8-1-2-9-6-14-7-15-12(9)16-11(8)5-10/h3-7H,1-2H2,(H,14,15,16) |
| InChIKey | NSESHEFSWQVPOS-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.69 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |