C8H9ClN2 — CID 117275331
6-chloro-1,2,3,4-tetrahydrocinnoline (PubChem CID 117275331) has the molecular formula C8H9ClN2 and a molecular weight of 168.63 g/mol. Its IUPAC name is 6-chloro-1,2,3,4-tetrahydrocinnoline.
| Compound Name | 6-chloro-1,2,3,4-tetrahydrocinnoline |
|---|---|
| PubChem CID | 117275331 |
| Molecular Formula | C8H9ClN2 |
| Molecular Weight | 168.63 g/mol |
| Exact Mass | 168.05 |
| IUPAC Name | 6-chloro-1,2,3,4-tetrahydrocinnoline |
| SMILES | Clc1ccc2c(c1)CCNN2 |
| InChI | InChI=1S/C8H9ClN2/c9-7-1-2-8-6(5-7)3-4-10-11-8/h1-2,5,10-11H,3-4H2 |
| InChIKey | VKIUYRVZFTZHLW-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.63 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |