C11H11N5 — CID 175299520
8-phenyl-8,9-dihydropurin-7-amine (PubChem CID 175299520) has the molecular formula C11H11N5 and a molecular weight of 213.24 g/mol. Its IUPAC name is 8-phenyl-8,9-dihydropurin-7-amine.
| Compound Name | 8-phenyl-8,9-dihydropurin-7-amine |
|---|---|
| PubChem CID | 175299520 |
| Molecular Formula | C11H11N5 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 8-phenyl-8,9-dihydropurin-7-amine |
| SMILES | NN1c2cncnc2NC1c1ccccc1 |
| InChI | InChI=1S/C11H11N5/c12-16-9-6-13-7-14-10(9)15-11(16)8-4-2-1-3-5-8/h1-7,11H,12H2,(H,13,14,15) |
| InChIKey | JMVJQHHTBCYQBG-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|