C18H20N6 — CID 175126573
(3S)-1-[5-(2-phenylimidazol-1-yl)pyrimidin-4-yl]piperidin-3-amine (PubChem CID 175126573) has the molecular formula C18H20N6 and a molecular weight of 320.40 g/mol. Its IUPAC name is (3S)-1-[5-(2-phenylimidazol-1-yl)pyrimidin-4-yl]piperidin-3-amine.
| Compound Name | (3S)-1-[5-(2-phenylimidazol-1-yl)pyrimidin-4-yl]piperidin-3-amine |
|---|---|
| PubChem CID | 175126573 |
| Molecular Formula | C18H20N6 |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | (3S)-1-[5-(2-phenylimidazol-1-yl)pyrimidin-4-yl]piperidin-3-amine |
| SMILES | N[C@H]1CCCN(c2ncncc2-n2ccnc2-c2ccccc2)C1 |
| InChI | InChI=1S/C18H20N6/c19-15-7-4-9-23(12-15)18-16(11-20-13-22-18)24-10-8-21-17(24)14-5-2-1-3-6-14/h1-3,5-6,8,10-11,13,15H,4,7,9,12,19H2/t15-/m0/s1 |
| InChIKey | ANRRRWHXZRDPRD-HNNXBMFYSA-N |
| XLogP | 2.26 |
| TPSA | 72.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |