C11H15N5 — CID 91811933
1-pyrazolo[1,5-a]pyrazin-4-ylpiperidin-3-amine (PubChem CID 91811933) has the molecular formula C11H15N5 and a molecular weight of 217.28 g/mol. Its IUPAC name is 1-pyrazolo[1,5-a]pyrazin-4-ylpiperidin-3-amine.
| Compound Name | 1-pyrazolo[1,5-a]pyrazin-4-ylpiperidin-3-amine |
|---|---|
| PubChem CID | 91811933 |
| Molecular Formula | C11H15N5 |
| Molecular Weight | 217.28 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | 1-pyrazolo[1,5-a]pyrazin-4-ylpiperidin-3-amine |
| SMILES | NC1CCCN(c2nccn3nccc23)C1 |
| InChI | InChI=1S/C11H15N5/c12-9-2-1-6-15(8-9)11-10-3-4-14-16(10)7-5-13-11/h3-5,7,9H,1-2,6,8,12H2 |
| InChIKey | INNXNQXHVJUVNA-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 59.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.28 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |