C15H17N5S — CID 56771006
1-(2-thiophen-2-ylpyrazolo[1,5-a]pyrazin-4-yl)piperidin-3-amine (PubChem CID 56771006) has the molecular formula C15H17N5S and a molecular weight of 299.40 g/mol. Its IUPAC name is 1-(2-thiophen-2-ylpyrazolo[1,5-a]pyrazin-4-yl)piperidin-3-amine.
| Compound Name | 1-(2-thiophen-2-ylpyrazolo[1,5-a]pyrazin-4-yl)piperidin-3-amine |
|---|---|
| PubChem CID | 56771006 |
| Molecular Formula | C15H17N5S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 1-(2-thiophen-2-ylpyrazolo[1,5-a]pyrazin-4-yl)piperidin-3-amine |
| SMILES | NC1CCCN(c2nccn3nc(-c4cccs4)cc23)C1 |
| InChI | InChI=1S/C15H17N5S/c16-11-3-1-6-19(10-11)15-13-9-12(14-4-2-8-21-14)18-20(13)7-5-17-15/h2,4-5,7-9,11H,1,3,6,10,16H2 |
| InChIKey | VKRPHJUYNHERKE-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 59.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |