C13H16N4O — CID 113446199
1-(1-pyrazolo[1,5-a]pyrazin-4-ylpiperidin-3-yl)ethanone (PubChem CID 113446199) has the molecular formula C13H16N4O and a molecular weight of 244.30 g/mol. Its IUPAC name is 1-(1-pyrazolo[1,5-a]pyrazin-4-ylpiperidin-3-yl)ethanone.
| Compound Name | 1-(1-pyrazolo[1,5-a]pyrazin-4-ylpiperidin-3-yl)ethanone |
|---|---|
| PubChem CID | 113446199 |
| Molecular Formula | C13H16N4O |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 1-(1-pyrazolo[1,5-a]pyrazin-4-ylpiperidin-3-yl)ethanone |
| SMILES | CC(=O)C1CCCN(c2nccn3nccc23)C1 |
| InChI | InChI=1S/C13H16N4O/c1-10(18)11-3-2-7-16(9-11)13-12-4-5-15-17(12)8-6-14-13/h4-6,8,11H,2-3,7,9H2,1H3 |
| InChIKey | ZXIIUOIYDYTIQS-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |