C12H16N2 — CID 89116853
(9aS)-5,5a,6,7,8,9,9a,10-octahydrobenzo[g]quinazoline (PubChem CID 89116853) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is (9aS)-5,5a,6,7,8,9,9a,10-octahydrobenzo[g]quinazoline.
| Compound Name | (9aS)-5,5a,6,7,8,9,9a,10-octahydrobenzo[g]quinazoline |
|---|---|
| PubChem CID | 89116853 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | (9aS)-5,5a,6,7,8,9,9a,10-octahydrobenzo[g]quinazoline |
| SMILES | c1ncc2c(n1)C[C@@H]1CCCCC1C2 |
| InChI | InChI=1S/C12H16N2/c1-2-4-10-6-12-11(5-9(10)3-1)7-13-8-14-12/h7-10H,1-6H2/t9?,10-/m0/s1 |
| InChIKey | QYGTYEIASCDTMI-AXDSSHIGSA-N |
| XLogP | 2.38 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |