C10H13N3 — CID 59318443
5a,6,7,8,9,9a-hexahydro-5H-pyrazino[2,3-b]indole (PubChem CID 59318443) has the molecular formula C10H13N3 and a molecular weight of 175.24 g/mol. Its IUPAC name is 5a,6,7,8,9,9a-hexahydro-5H-pyrazino[2,3-b]indole.
| Compound Name | 5a,6,7,8,9,9a-hexahydro-5H-pyrazino[2,3-b]indole |
|---|---|
| PubChem CID | 59318443 |
| Molecular Formula | C10H13N3 |
| Molecular Weight | 175.24 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | 5a,6,7,8,9,9a-hexahydro-5H-pyrazino[2,3-b]indole |
| SMILES | c1cnc2c(n1)NC1CCCCC21 |
| InChI | InChI=1S/C10H13N3/c1-2-4-8-7(3-1)9-10(13-8)12-6-5-11-9/h5-8H,1-4H2,(H,12,13) |
| InChIKey | DINUEIXSDAJTRS-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.24 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |