C9H13NOS — CID 136791169
(4aR,8aR)-4-hydroxy-4a,5,6,7,8,8a-hexahydro-1H-quinoline-2-thione (PubChem CID 136791169) has the molecular formula C9H13NOS and a molecular weight of 183.28 g/mol. Its IUPAC name is (4aR,8aR)-4-hydroxy-4a,5,6,7,8,8a-hexahydro-1H-quinoline-2-thione.
| Compound Name | (4aR,8aR)-4-hydroxy-4a,5,6,7,8,8a-hexahydro-1H-quinoline-2-thione |
|---|---|
| PubChem CID | 136791169 |
| Molecular Formula | C9H13NOS |
| Molecular Weight | 183.28 g/mol |
| Exact Mass | 183.07 |
| IUPAC Name | (4aR,8aR)-4-hydroxy-4a,5,6,7,8,8a-hexahydro-1H-quinoline-2-thione |
| SMILES | OC1=CC(=S)N[C@@H]2CCCC[C@@H]12 |
| InChI | InChI=1S/C9H13NOS/c11-8-5-9(12)10-7-4-2-1-3-6(7)8/h5-7,11H,1-4H2,(H,10,12)/t6-,7-/m1/s1 |
| InChIKey | VAPCKLBUNPZZAQ-RNFRBKRXSA-N |
| XLogP | 1.92 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.28 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|