C9H14O — CID 135083439
(3aR,7aS)-3a,4,5,6,7,7a-hexahydro-3H-inden-1-ol (PubChem CID 135083439) has the molecular formula C9H14O and a molecular weight of 138.21 g/mol. Its IUPAC name is (3aR,7aS)-3a,4,5,6,7,7a-hexahydro-3H-inden-1-ol.
| Compound Name | (3aR,7aS)-3a,4,5,6,7,7a-hexahydro-3H-inden-1-ol |
|---|---|
| PubChem CID | 135083439 |
| Molecular Formula | C9H14O |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.10 |
| IUPAC Name | (3aR,7aS)-3a,4,5,6,7,7a-hexahydro-3H-inden-1-ol |
| SMILES | OC1=CC[C@H]2CCCC[C@H]12 |
| InChI | InChI=1S/C9H14O/c10-9-6-5-7-3-1-2-4-8(7)9/h6-8,10H,1-5H2/t7-,8+/m1/s1 |
| InChIKey | FRNGLDZPDSXLQP-SFYZADRCSA-N |
| XLogP | 2.64 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |