C13H16O — CID 129388444
(4bS,8aR)-5,6,7,8,8a,9-hexahydro-4bH-fluoren-2-ol (PubChem CID 129388444) has the molecular formula C13H16O and a molecular weight of 188.27 g/mol. Its IUPAC name is (4bS,8aR)-5,6,7,8,8a,9-hexahydro-4bH-fluoren-2-ol.
| Compound Name | (4bS,8aR)-5,6,7,8,8a,9-hexahydro-4bH-fluoren-2-ol |
|---|---|
| PubChem CID | 129388444 |
| Molecular Formula | C13H16O |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | (4bS,8aR)-5,6,7,8,8a,9-hexahydro-4bH-fluoren-2-ol |
| SMILES | Oc1ccc2c(c1)C[C@H]1CCCC[C@H]21 |
| InChI | InChI=1S/C13H16O/c14-11-5-6-13-10(8-11)7-9-3-1-2-4-12(9)13/h5-6,8-9,12,14H,1-4,7H2/t9-,12+/m1/s1 |
| InChIKey | NSCCCRCGJBJLOR-SKDRFNHKSA-N |
| XLogP | 3.22 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |