C14H18O2 — CID 146232812
1,2,3,4,4a,9,10,10a-octahydrophenanthrene-2,7-diol (PubChem CID 146232812) has the molecular formula C14H18O2 and a molecular weight of 218.30 g/mol. Its IUPAC name is 1,2,3,4,4a,9,10,10a-octahydrophenanthrene-2,7-diol.
| Compound Name | 1,2,3,4,4a,9,10,10a-octahydrophenanthrene-2,7-diol |
|---|---|
| PubChem CID | 146232812 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 1,2,3,4,4a,9,10,10a-octahydrophenanthrene-2,7-diol |
| SMILES | Oc1ccc2c(c1)CCC1CC(O)CCC21 |
| InChI | InChI=1S/C14H18O2/c15-11-3-5-13-9(7-11)1-2-10-8-12(16)4-6-14(10)13/h3,5,7,10,12,14-16H,1-2,4,6,8H2 |
| InChIKey | GDRAWANOQYARNN-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |