C19H30O — CID 142151441
6-ethyl-4b,5,6,7,8,8a,9,10-octahydrophenanthren-2-ol;propane (PubChem CID 142151441) has the molecular formula C19H30O and a molecular weight of 274.45 g/mol. Its IUPAC name is 6-ethyl-4b,5,6,7,8,8a,9,10-octahydrophenanthren-2-ol;propane.
| Compound Name | 6-ethyl-4b,5,6,7,8,8a,9,10-octahydrophenanthren-2-ol;propane |
|---|---|
| PubChem CID | 142151441 |
| Molecular Formula | C19H30O |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.23 |
| IUPAC Name | 6-ethyl-4b,5,6,7,8,8a,9,10-octahydrophenanthren-2-ol;propane |
| SMILES | CCC.CCC1CCC2CCc3cc(O)ccc3C2C1 |
| InChI | InChI=1S/C16H22O.C3H8/c1-2-11-3-4-12-5-6-13-10-14(17)7-8-15(13)16(12)9-11;1-3-2/h7-8,10-12,16-17H,2-6,9H2,1H3;3H2,1-2H3 |
| InChIKey | PDEXXHRLKRIOFP-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |