C18H26O — CID 22384398
4-(6-ethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)phenol (PubChem CID 22384398) has the molecular formula C18H26O and a molecular weight of 258.40 g/mol. Its IUPAC name is 4-(6-ethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)phenol.
| Compound Name | 4-(6-ethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)phenol |
|---|---|
| PubChem CID | 22384398 |
| Molecular Formula | C18H26O |
| Molecular Weight | 258.40 g/mol |
| Exact Mass | 258.20 |
| IUPAC Name | 4-(6-ethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)phenol |
| SMILES | CCC1CCC2CC(c3ccc(O)cc3)CCC2C1 |
| InChI | InChI=1S/C18H26O/c1-2-13-3-4-17-12-16(6-5-15(17)11-13)14-7-9-18(19)10-8-14/h7-10,13,15-17,19H,2-6,11-12H2,1H3 |
| InChIKey | QEUPOTVNNOPEDC-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.40 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |