C28H34 — CID 20809788
(4aR,6R,8aR)-2-ethyl-6-[4-[2-(4-ethylphenyl)ethynyl]phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 20809788) has the molecular formula C28H34 and a molecular weight of 370.58 g/mol. Its IUPAC name is (4aR,6R,8aR)-2-ethyl-6-[4-[2-(4-ethylphenyl)ethynyl]phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | (4aR,6R,8aR)-2-ethyl-6-[4-[2-(4-ethylphenyl)ethynyl]phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 20809788 |
| Molecular Formula | C28H34 |
| Molecular Weight | 370.58 g/mol |
| Exact Mass | 370.27 |
| IUPAC Name | (4aR,6R,8aR)-2-ethyl-6-[4-[2-(4-ethylphenyl)ethynyl]phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | CCc1ccc(C#Cc2ccc([C@@H]3CC[C@@H]4CC(CC)CC[C@@H]4C3)cc2)cc1 |
| InChI | InChI=1S/C28H34/c1-3-21-5-7-23(8-6-21)9-10-24-12-14-25(15-13-24)27-18-17-26-19-22(4-2)11-16-28(26)20-27/h5-8,12-15,22,26-28H,3-4,11,16-20H2,1-2H3/t22?,26-,27-,28-/m1/s1 |
| InChIKey | DLACXNMIVBKOBI-ZQCUGPNOSA-N |
| XLogP | 7.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.58 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|