C18H25Cl — CID 20809545
(2R,4aR,8aR)-2-(4-chlorophenyl)-6-ethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 20809545) has the molecular formula C18H25Cl and a molecular weight of 276.85 g/mol. Its IUPAC name is (2R,4aR,8aR)-2-(4-chlorophenyl)-6-ethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | (2R,4aR,8aR)-2-(4-chlorophenyl)-6-ethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 20809545 |
| Molecular Formula | C18H25Cl |
| Molecular Weight | 276.85 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | (2R,4aR,8aR)-2-(4-chlorophenyl)-6-ethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | CCC1CC[C@@H]2C[C@H](c3ccc(Cl)cc3)CC[C@@H]2C1 |
| InChI | InChI=1S/C18H25Cl/c1-2-13-3-4-17-12-16(6-5-15(17)11-13)14-7-9-18(19)10-8-14/h7-10,13,15-17H,2-6,11-12H2,1H3/t13?,15-,16-,17-/m1/s1 |
| InChIKey | QJKKENLZPSYUOJ-SDAGNLPFSA-N |
| XLogP | 6.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.85 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |