C20H29ClO — CID 139865136
2-butoxy-6-(4-chlorophenyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 139865136) has the molecular formula C20H29ClO and a molecular weight of 320.90 g/mol. Its IUPAC name is 2-butoxy-6-(4-chlorophenyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | 2-butoxy-6-(4-chlorophenyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 139865136 |
| Molecular Formula | C20H29ClO |
| Molecular Weight | 320.90 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | 2-butoxy-6-(4-chlorophenyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | CCCCOC1CCC2CC(c3ccc(Cl)cc3)CCC2C1 |
| InChI | InChI=1S/C20H29ClO/c1-2-3-12-22-20-11-8-17-13-16(4-5-18(17)14-20)15-6-9-19(21)10-7-15/h6-7,9-10,16-18,20H,2-5,8,11-14H2,1H3 |
| InChIKey | JOHQRRSZHSWFER-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.90 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|