C17H23Cl — CID 22384197
2-(4-chlorophenyl)-6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 22384197) has the molecular formula C17H23Cl and a molecular weight of 262.82 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | 2-(4-chlorophenyl)-6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 22384197 |
| Molecular Formula | C17H23Cl |
| Molecular Weight | 262.82 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | 2-(4-chlorophenyl)-6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | CC1CCC2CC(c3ccc(Cl)cc3)CCC2C1 |
| InChI | InChI=1S/C17H23Cl/c1-12-2-3-16-11-15(5-4-14(16)10-12)13-6-8-17(18)9-7-13/h6-9,12,14-16H,2-5,10-11H2,1H3 |
| InChIKey | CQOJOLXSMFKADU-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.82 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |