C24H27ClF2 — CID 20809309
(2R,4aR,8aR)-2-[4-(4-chloro-3,5-difluorophenyl)phenyl]-6-ethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 20809309) has the molecular formula C24H27ClF2 and a molecular weight of 388.93 g/mol. Its IUPAC name is (2R,4aR,8aR)-2-[4-(4-chloro-3,5-difluorophenyl)phenyl]-6-ethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | (2R,4aR,8aR)-2-[4-(4-chloro-3,5-difluorophenyl)phenyl]-6-ethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 20809309 |
| Molecular Formula | C24H27ClF2 |
| Molecular Weight | 388.93 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | (2R,4aR,8aR)-2-[4-(4-chloro-3,5-difluorophenyl)phenyl]-6-ethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | CCC1CC[C@@H]2C[C@H](c3ccc(-c4cc(F)c(Cl)c(F)c4)cc3)CC[C@@H]2C1 |
| InChI | InChI=1S/C24H27ClF2/c1-2-15-3-4-20-12-19(10-9-18(20)11-15)16-5-7-17(8-6-16)21-13-22(26)24(25)23(27)14-21/h5-8,13-15,18-20H,2-4,9-12H2,1H3/t15?,18-,19-,20-/m1/s1 |
| InChIKey | IHXWHOJXLYVVAK-NKSDPYKRSA-N |
| XLogP | 8.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.93 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|