C18H18O3 — CID 19431313
5,6,6a,7,8,12b-hexahydrobenzo[g]phenanthrene-2,3,10-triol (PubChem CID 19431313) has the molecular formula C18H18O3 and a molecular weight of 282.34 g/mol. Its IUPAC name is 5,6,6a,7,8,12b-hexahydrobenzo[g]phenanthrene-2,3,10-triol.
| Compound Name | 5,6,6a,7,8,12b-hexahydrobenzo[g]phenanthrene-2,3,10-triol |
|---|---|
| PubChem CID | 19431313 |
| Molecular Formula | C18H18O3 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | 5,6,6a,7,8,12b-hexahydrobenzo[g]phenanthrene-2,3,10-triol |
| SMILES | Oc1ccc2c(c1)CCC1CCc3cc(O)c(O)cc3C21 |
| InChI | InChI=1S/C18H18O3/c19-13-5-6-14-11(7-13)3-1-10-2-4-12-8-16(20)17(21)9-15(12)18(10)14/h5-10,18-21H,1-4H2 |
| InChIKey | SGMLBPJVPZMKCK-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|