C23H19F3O4S — CID 164923584
[4-(6-hydroxy-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl)phenyl] trifluoromethanesulfonate (PubChem CID 164923584) has the molecular formula C23H19F3O4S and a molecular weight of 448.46 g/mol. Its IUPAC name is [4-(6-hydroxy-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl)phenyl] trifluoromethanesulfonate.
| Compound Name | [4-(6-hydroxy-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl)phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 164923584 |
| Molecular Formula | C23H19F3O4S |
| Molecular Weight | 448.46 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | [4-(6-hydroxy-2-phenyl-1,2,3,4-tetrahydronaphthalen-1-yl)phenyl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1ccc(C2c3ccc(O)cc3CCC2c2ccccc2)cc1)C(F)(F)F |
| InChI | InChI=1S/C23H19F3O4S/c24-23(25,26)31(28,29)30-19-10-6-16(7-11-19)22-20(15-4-2-1-3-5-15)12-8-17-14-18(27)9-13-21(17)22/h1-7,9-11,13-14,20,22,27H,8,12H2 |
| InChIKey | UWIHGMUPGZAKHI-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.46 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|