C28H32O4 — CID 134562590
(5R,6S)-5-[4-(2,2-diethoxyethoxy)phenyl]-6-phenyl-5,6,7,8-tetrahydronaphthalen-2-ol (PubChem CID 134562590) has the molecular formula C28H32O4 and a molecular weight of 432.56 g/mol. Its IUPAC name is (5R,6S)-5-[4-(2,2-diethoxyethoxy)phenyl]-6-phenyl-5,6,7,8-tetrahydronaphthalen-2-ol.
| Compound Name | (5R,6S)-5-[4-(2,2-diethoxyethoxy)phenyl]-6-phenyl-5,6,7,8-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 134562590 |
| Molecular Formula | C28H32O4 |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | (5R,6S)-5-[4-(2,2-diethoxyethoxy)phenyl]-6-phenyl-5,6,7,8-tetrahydronaphthalen-2-ol |
| SMILES | CCOC(COc1ccc([C@@H]2c3ccc(O)cc3CC[C@@H]2c2ccccc2)cc1)OCC |
| InChI | InChI=1S/C28H32O4/c1-3-30-27(31-4-2)19-32-24-14-10-21(11-15-24)28-25(20-8-6-5-7-9-20)16-12-22-18-23(29)13-17-26(22)28/h5-11,13-15,17-18,25,27-29H,3-4,12,16,19H2,1-2H3/t25-,28+/m1/s1 |
| InChIKey | RIEFSZMHJAXPOX-NAKRPHOHSA-N |
| XLogP | 6.03 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|