C24H21FO3 — CID 134582432
2-[4-[(1R,2S)-2-(4-fluorophenyl)-6-hydroxy-1,2,3,4-tetrahydronaphthalen-1-yl]phenoxy]acetaldehyde (PubChem CID 134582432) has the molecular formula C24H21FO3 and a molecular weight of 376.43 g/mol. Its IUPAC name is 2-[4-[(1R,2S)-2-(4-fluorophenyl)-6-hydroxy-1,2,3,4-tetrahydronaphthalen-1-yl]phenoxy]acetaldehyde.
| Compound Name | 2-[4-[(1R,2S)-2-(4-fluorophenyl)-6-hydroxy-1,2,3,4-tetrahydronaphthalen-1-yl]phenoxy]acetaldehyde |
|---|---|
| PubChem CID | 134582432 |
| Molecular Formula | C24H21FO3 |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | 2-[4-[(1R,2S)-2-(4-fluorophenyl)-6-hydroxy-1,2,3,4-tetrahydronaphthalen-1-yl]phenoxy]acetaldehyde |
| SMILES | O=CCOc1ccc([C@@H]2c3ccc(O)cc3CC[C@@H]2c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C24H21FO3/c25-19-6-1-16(2-7-19)22-11-5-18-15-20(27)8-12-23(18)24(22)17-3-9-21(10-4-17)28-14-13-26/h1-4,6-10,12-13,15,22,24,27H,5,11,14H2/t22-,24+/m1/s1 |
| InChIKey | QQDDGEWXCAQFSO-VWNXMTODSA-N |
| XLogP | 4.97 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|