C30H32FNO2 — CID 70149506
N,N-diethyl-3-[4-[(1R,2S)-2-(4-fluorophenyl)-6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl]prop-2-enamide (PubChem CID 70149506) has the molecular formula C30H32FNO2 and a molecular weight of 457.59 g/mol. Its IUPAC name is N,N-diethyl-3-[4-[(1R,2S)-2-(4-fluorophenyl)-6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl]prop-2-enamide.
| Compound Name | N,N-diethyl-3-[4-[(1R,2S)-2-(4-fluorophenyl)-6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 70149506 |
| Molecular Formula | C30H32FNO2 |
| Molecular Weight | 457.59 g/mol |
| Exact Mass | 457.24 |
| IUPAC Name | N,N-diethyl-3-[4-[(1R,2S)-2-(4-fluorophenyl)-6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl]phenyl]prop-2-enamide |
| SMILES | CCN(CC)C(=O)C=Cc1ccc([C@@H]2c3ccc(OC)cc3CC[C@@H]2c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C30H32FNO2/c1-4-32(5-2)29(33)19-8-21-6-9-23(10-7-21)30-27(22-11-14-25(31)15-12-22)17-13-24-20-26(34-3)16-18-28(24)30/h6-12,14-16,18-20,27,30H,4-5,13,17H2,1-3H3/t27-,30+/m1/s1 |
| InChIKey | YGRCUGKASXVUEG-OFSOJUDTSA-N |
| XLogP | 6.58 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.59 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|