C19H24O3 — CID 68832214
(2R,4aR,10aR)-2-cyclopropyl-1-ethyl-2,7-dihydroxy-1,4,4a,9,10,10a-hexahydrophenanthren-3-one (PubChem CID 68832214) has the molecular formula C19H24O3 and a molecular weight of 300.40 g/mol. Its IUPAC name is (2R,4aR,10aR)-2-cyclopropyl-1-ethyl-2,7-dihydroxy-1,4,4a,9,10,10a-hexahydrophenanthren-3-one.
| Compound Name | (2R,4aR,10aR)-2-cyclopropyl-1-ethyl-2,7-dihydroxy-1,4,4a,9,10,10a-hexahydrophenanthren-3-one |
|---|---|
| PubChem CID | 68832214 |
| Molecular Formula | C19H24O3 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | (2R,4aR,10aR)-2-cyclopropyl-1-ethyl-2,7-dihydroxy-1,4,4a,9,10,10a-hexahydrophenanthren-3-one |
| SMILES | CCC1[C@@H]2CCc3cc(O)ccc3[C@@H]2CC(=O)[C@@]1(O)C1CC1 |
| InChI | InChI=1S/C19H24O3/c1-2-17-15-7-3-11-9-13(20)6-8-14(11)16(15)10-18(21)19(17,22)12-4-5-12/h6,8-9,12,15-17,20,22H,2-5,7,10H2,1H3/t15-,16+,17?,19-/m1/s1 |
| InChIKey | BQIXODZINUUUJO-SUTQANCOSA-N |
| XLogP | 3.18 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |