C16H22 — CID 21032882
2,7-dimethyl-1,2,3,4,4a,9,10,10a-octahydrophenanthrene (PubChem CID 21032882) has the molecular formula C16H22 and a molecular weight of 214.35 g/mol. Its IUPAC name is 2,7-dimethyl-1,2,3,4,4a,9,10,10a-octahydrophenanthrene.
| Compound Name | 2,7-dimethyl-1,2,3,4,4a,9,10,10a-octahydrophenanthrene |
|---|---|
| PubChem CID | 21032882 |
| Molecular Formula | C16H22 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | 2,7-dimethyl-1,2,3,4,4a,9,10,10a-octahydrophenanthrene |
| SMILES | Cc1ccc2c(c1)CCC1CC(C)CCC21 |
| InChI | InChI=1S/C16H22/c1-11-3-7-15-13(9-11)5-6-14-10-12(2)4-8-16(14)15/h3,7,9,12,14,16H,4-6,8,10H2,1-2H3 |
| InChIKey | JQVRQKVJVCOITR-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |