C18H22O4 — CID 53321635
(8S,9S,14S,16R,17R)-3,17-dihydroxy-7,8,9,11,12,13,14,15,16,17-decahydro-6H-cyclopenta[a]phenanthrene-16-carboxylic acid (PubChem CID 53321635) has the molecular formula C18H22O4 and a molecular weight of 302.37 g/mol. Its IUPAC name is (8S,9S,14S,16R,17R)-3,17-dihydroxy-7,8,9,11,12,13,14,15,16,17-decahydro-6H-cyclopenta[a]phenanthrene-16-carboxylic acid.
| Compound Name | (8S,9S,14S,16R,17R)-3,17-dihydroxy-7,8,9,11,12,13,14,15,16,17-decahydro-6H-cyclopenta[a]phenanthrene-16-carboxylic acid |
|---|---|
| PubChem CID | 53321635 |
| Molecular Formula | C18H22O4 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | (8S,9S,14S,16R,17R)-3,17-dihydroxy-7,8,9,11,12,13,14,15,16,17-decahydro-6H-cyclopenta[a]phenanthrene-16-carboxylic acid |
| SMILES | O=C(O)[C@@H]1C[C@@H]2C(CC[C@@H]3c4ccc(O)cc4CC[C@H]32)[C@H]1O |
| InChI | InChI=1S/C18H22O4/c19-10-2-4-11-9(7-10)1-3-13-12(11)5-6-14-15(13)8-16(17(14)20)18(21)22/h2,4,7,12-17,19-20H,1,3,5-6,8H2,(H,21,22)/t12-,13-,14?,15+,16-,17-/m1/s1 |
| InChIKey | IIPMDMBADKOUTH-DDGPGRFVSA-N |
| XLogP | 2.53 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |