C19H26O2 — CID 123535129
3-methoxy-16-methyl-7,8,9,11,12,13,14,15,16,17-decahydro-6H-cyclopenta[a]phenanthren-17-ol (PubChem CID 123535129) has the molecular formula C19H26O2 and a molecular weight of 286.41 g/mol. Its IUPAC name is 3-methoxy-16-methyl-7,8,9,11,12,13,14,15,16,17-decahydro-6H-cyclopenta[a]phenanthren-17-ol.
| Compound Name | 3-methoxy-16-methyl-7,8,9,11,12,13,14,15,16,17-decahydro-6H-cyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 123535129 |
| Molecular Formula | C19H26O2 |
| Molecular Weight | 286.41 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | 3-methoxy-16-methyl-7,8,9,11,12,13,14,15,16,17-decahydro-6H-cyclopenta[a]phenanthren-17-ol |
| SMILES | COc1ccc2c(c1)CCC1C2CCC2C(O)C(C)CC12 |
| InChI | InChI=1S/C19H26O2/c1-11-9-18-16-5-3-12-10-13(21-2)4-6-14(12)15(16)7-8-17(18)19(11)20/h4,6,10-11,15-20H,3,5,7-9H2,1-2H3 |
| InChIKey | KAKRGOVHCPUNLQ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.41 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |