C17H24OS — CID 54752033
(4R,4aS,10bR)-8-methoxy-4-propyl-2,4,4a,5,6,10b-hexahydro-1H-benzo[f]isothiochromene (PubChem CID 54752033) has the molecular formula C17H24OS and a molecular weight of 276.44 g/mol. Its IUPAC name is (4R,4aS,10bR)-8-methoxy-4-propyl-2,4,4a,5,6,10b-hexahydro-1H-benzo[f]isothiochromene.
| Compound Name | (4R,4aS,10bR)-8-methoxy-4-propyl-2,4,4a,5,6,10b-hexahydro-1H-benzo[f]isothiochromene |
|---|---|
| PubChem CID | 54752033 |
| Molecular Formula | C17H24OS |
| Molecular Weight | 276.44 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | (4R,4aS,10bR)-8-methoxy-4-propyl-2,4,4a,5,6,10b-hexahydro-1H-benzo[f]isothiochromene |
| SMILES | CCC[C@H]1SCC[C@H]2c3ccc(OC)cc3CC[C@H]12 |
| InChI | InChI=1S/C17H24OS/c1-3-4-17-16-7-5-12-11-13(18-2)6-8-14(12)15(16)9-10-19-17/h6,8,11,15-17H,3-5,7,9-10H2,1-2H3/t15-,16-,17+/m0/s1 |
| InChIKey | WQIDLWDZPCKWOR-YESZJQIVSA-N |
| XLogP | 4.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.44 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |