C20H28O2 — CID 150061489
(1R,2S,4aS,10aR)-1-butyl-7-methoxy-2-methyl-2,4,4a,9,10,10a-hexahydro-1H-phenanthren-3-one (PubChem CID 150061489) has the molecular formula C20H28O2 and a molecular weight of 300.44 g/mol. Its IUPAC name is (1R,2S,4aS,10aR)-1-butyl-7-methoxy-2-methyl-2,4,4a,9,10,10a-hexahydro-1H-phenanthren-3-one.
| Compound Name | (1R,2S,4aS,10aR)-1-butyl-7-methoxy-2-methyl-2,4,4a,9,10,10a-hexahydro-1H-phenanthren-3-one |
|---|---|
| PubChem CID | 150061489 |
| Molecular Formula | C20H28O2 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | (1R,2S,4aS,10aR)-1-butyl-7-methoxy-2-methyl-2,4,4a,9,10,10a-hexahydro-1H-phenanthren-3-one |
| SMILES | CCCC[C@@H]1[C@H]2CCc3cc(OC)ccc3[C@H]2CC(=O)[C@H]1C |
| InChI | InChI=1S/C20H28O2/c1-4-5-6-16-13(2)20(21)12-19-17-10-8-15(22-3)11-14(17)7-9-18(16)19/h8,10-11,13,16,18-19H,4-7,9,12H2,1-3H3/t13-,16-,18+,19+/m0/s1 |
| InChIKey | DNJUPYQYAPDKRE-PTKHLAPESA-N |
| XLogP | 4.76 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |