C20H27IO2 — CID 101192156
(1S,3S,4aS,4bS,10bS,12R)-3-iodo-8-methoxy-12-methyl-1,2,3,4,4a,4b,5,6,10b,11,12,12a-dodecahydrochrysen-1-ol (PubChem CID 101192156) has the molecular formula C20H27IO2 and a molecular weight of 426.34 g/mol. Its IUPAC name is (1S,3S,4aS,4bS,10bS,12R)-3-iodo-8-methoxy-12-methyl-1,2,3,4,4a,4b,5,6,10b,11,12,12a-dodecahydrochrysen-1-ol.
| Compound Name | (1S,3S,4aS,4bS,10bS,12R)-3-iodo-8-methoxy-12-methyl-1,2,3,4,4a,4b,5,6,10b,11,12,12a-dodecahydrochrysen-1-ol |
|---|---|
| PubChem CID | 101192156 |
| Molecular Formula | C20H27IO2 |
| Molecular Weight | 426.34 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | (1S,3S,4aS,4bS,10bS,12R)-3-iodo-8-methoxy-12-methyl-1,2,3,4,4a,4b,5,6,10b,11,12,12a-dodecahydrochrysen-1-ol |
| SMILES | COc1ccc2c(c1)CC[C@@H]1[C@@H]2CC(C)C2[C@H]1C[C@H](I)C[C@@H]2O |
| InChI | InChI=1S/C20H27IO2/c1-11-7-17-15-6-4-14(23-2)8-12(15)3-5-16(17)18-9-13(21)10-19(22)20(11)18/h4,6,8,11,13,16-20,22H,3,5,7,9-10H2,1-2H3/t11?,13-,16+,17+,18-,19-,20?/m0/s1 |
| InChIKey | IUOQLEAJJUACNK-GVMIQKNDSA-N |
| XLogP | 4.57 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.34 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|