C22H31FO2 — CID 101192163
(1S,3S,4aS,4bS,10bS,12R)-1-ethoxy-3-fluoro-8-methoxy-12-methyl-1,2,3,4,4a,4b,5,6,10b,11,12,12a-dodecahydrochrysene (PubChem CID 101192163) has the molecular formula C22H31FO2 and a molecular weight of 346.49 g/mol. Its IUPAC name is (1S,3S,4aS,4bS,10bS,12R)-1-ethoxy-3-fluoro-8-methoxy-12-methyl-1,2,3,4,4a,4b,5,6,10b,11,12,12a-dodecahydrochrysene.
| Compound Name | (1S,3S,4aS,4bS,10bS,12R)-1-ethoxy-3-fluoro-8-methoxy-12-methyl-1,2,3,4,4a,4b,5,6,10b,11,12,12a-dodecahydrochrysene |
|---|---|
| PubChem CID | 101192163 |
| Molecular Formula | C22H31FO2 |
| Molecular Weight | 346.49 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | (1S,3S,4aS,4bS,10bS,12R)-1-ethoxy-3-fluoro-8-methoxy-12-methyl-1,2,3,4,4a,4b,5,6,10b,11,12,12a-dodecahydrochrysene |
| SMILES | CCO[C@H]1C[C@@H](F)C[C@@H]2C1C(C)C[C@@H]1c3ccc(OC)cc3CC[C@H]12 |
| InChI | InChI=1S/C22H31FO2/c1-4-25-21-12-15(23)11-20-18-7-5-14-10-16(24-3)6-8-17(14)19(18)9-13(2)22(20)21/h6,8,10,13,15,18-22H,4-5,7,9,11-12H2,1-3H3/t13?,15-,18+,19+,20-,21-,22?/m0/s1 |
| InChIKey | JFONMZPZGBKCTO-RAHHCSJZSA-N |
| XLogP | 5.15 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.49 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |