C20H25FO4 — CID 10247156
2-fluoroethyl (16R)-3,17-dihydroxy-7,8,9,11,12,13,14,15,16,17-decahydro-6H-cyclopenta[a]phenanthrene-16-carboxylate (PubChem CID 10247156) has the molecular formula C20H25FO4 and a molecular weight of 348.41 g/mol. Its IUPAC name is 2-fluoroethyl (16R)-3,17-dihydroxy-7,8,9,11,12,13,14,15,16,17-decahydro-6H-cyclopenta[a]phenanthrene-16-carboxylate.
| Compound Name | 2-fluoroethyl (16R)-3,17-dihydroxy-7,8,9,11,12,13,14,15,16,17-decahydro-6H-cyclopenta[a]phenanthrene-16-carboxylate |
|---|---|
| PubChem CID | 10247156 |
| Molecular Formula | C20H25FO4 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 2-fluoroethyl (16R)-3,17-dihydroxy-7,8,9,11,12,13,14,15,16,17-decahydro-6H-cyclopenta[a]phenanthrene-16-carboxylate |
| SMILES | O=C(OCCF)[C@@H]1CC2C3CCc4cc(O)ccc4C3CCC2C1O |
| InChI | InChI=1S/C20H25FO4/c21-7-8-25-20(24)18-10-17-15-3-1-11-9-12(22)2-4-13(11)14(15)5-6-16(17)19(18)23/h2,4,9,14-19,22-23H,1,3,5-8,10H2/t14?,15?,16?,17?,18-,19?/m1/s1 |
| InChIKey | ZGVCYTOEAHGRLG-OIAUPDTQSA-N |
| XLogP | 2.96 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |