C22H30O4 — CID 134298332
propan-2-yl (8R,9S,13S,14S,16S,17S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-16-carboxylate (PubChem CID 134298332) has the molecular formula C22H30O4 and a molecular weight of 358.48 g/mol. Its IUPAC name is propan-2-yl (8R,9S,13S,14S,16S,17S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-16-carboxylate.
| Compound Name | propan-2-yl (8R,9S,13S,14S,16S,17S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-16-carboxylate |
|---|---|
| PubChem CID | 134298332 |
| Molecular Formula | C22H30O4 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | propan-2-yl (8R,9S,13S,14S,16S,17S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-16-carboxylate |
| SMILES | CC(C)OC(=O)[C@H]1C[C@H]2[C@@H]3CCc4cc(O)ccc4[C@H]3CC[C@]2(C)[C@H]1O |
| InChI | InChI=1S/C22H30O4/c1-12(2)26-21(25)18-11-19-17-6-4-13-10-14(23)5-7-15(13)16(17)8-9-22(19,3)20(18)24/h5,7,10,12,16-20,23-24H,4,6,8-9,11H2,1-3H3/t16-,17-,18+,19+,20+,22+/m1/s1 |
| InChIKey | DWHCHWIIXJTBKW-DIRCKHNBSA-N |
| XLogP | 3.79 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |