C21H29NO3 — CID 71529260
(8R,9S,13S,14S,16S,17S)-3-hydroxy-17-methoxy-N,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-16-carboxamide (PubChem CID 71529260) has the molecular formula C21H29NO3 and a molecular weight of 343.47 g/mol. Its IUPAC name is (8R,9S,13S,14S,16S,17S)-3-hydroxy-17-methoxy-N,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-16-carboxamide.
| Compound Name | (8R,9S,13S,14S,16S,17S)-3-hydroxy-17-methoxy-N,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-16-carboxamide |
|---|---|
| PubChem CID | 71529260 |
| Molecular Formula | C21H29NO3 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | (8R,9S,13S,14S,16S,17S)-3-hydroxy-17-methoxy-N,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-16-carboxamide |
| SMILES | CNC(=O)[C@H]1C[C@H]2[C@@H]3CCc4cc(O)ccc4[C@H]3CC[C@]2(C)[C@H]1OC |
| InChI | InChI=1S/C21H29NO3/c1-21-9-8-15-14-7-5-13(23)10-12(14)4-6-16(15)18(21)11-17(19(21)25-3)20(24)22-2/h5,7,10,15-19,23H,4,6,8-9,11H2,1-3H3,(H,22,24)/t15-,16-,17+,18+,19+,21+/m1/s1 |
| InChIKey | ISVPVAIXASGLJM-STRCNMCHSA-N |
| XLogP | 3.24 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |