C22H27O6- — CID 23616943
4-[[(8R,9S,13S,14S,16R,17R)-3,16-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]oxy]-4-oxobutanoate (PubChem CID 23616943) has the molecular formula C22H27O6- and a molecular weight of 387.45 g/mol. Its IUPAC name is 4-[[(8R,9S,13S,14S,16R,17R)-3,16-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]oxy]-4-oxobutanoate.
| Compound Name | 4-[[(8R,9S,13S,14S,16R,17R)-3,16-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]oxy]-4-oxobutanoate |
|---|---|
| PubChem CID | 23616943 |
| Molecular Formula | C22H27O6- |
| Molecular Weight | 387.45 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | 4-[[(8R,9S,13S,14S,16R,17R)-3,16-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]oxy]-4-oxobutanoate |
| SMILES | C[C@]12CC[C@@H]3c4ccc(O)cc4CC[C@H]3[C@@H]1C[C@@H](O)[C@@H]2OC(=O)CCC(=O)[O-] |
| InChI | InChI=1S/C22H28O6/c1-22-9-8-15-14-5-3-13(23)10-12(14)2-4-16(15)17(22)11-18(24)21(22)28-20(27)7-6-19(25)26/h3,5,10,15-18,21,23-24H,2,4,6-9,11H2,1H3,(H,25,26)/p-1/t15-,16-,17+,18-,21+,22+/m1/s1 |
| InChIKey | ZWEYRQCPAGSLQP-TZVXGSHHSA-M |
| XLogP | 1.66 |
| TPSA | 106.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.45 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |