C17H18O2 — CID 123703346
3'-ethynylspiro[5,6,8,8a,9,10-hexahydro-4bH-phenanthrene-7,2'-oxirane]-2-ol (PubChem CID 123703346) has the molecular formula C17H18O2 and a molecular weight of 254.33 g/mol. Its IUPAC name is 3'-ethynylspiro[5,6,8,8a,9,10-hexahydro-4bH-phenanthrene-7,2'-oxirane]-2-ol.
| Compound Name | 3'-ethynylspiro[5,6,8,8a,9,10-hexahydro-4bH-phenanthrene-7,2'-oxirane]-2-ol |
|---|---|
| PubChem CID | 123703346 |
| Molecular Formula | C17H18O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 3'-ethynylspiro[5,6,8,8a,9,10-hexahydro-4bH-phenanthrene-7,2'-oxirane]-2-ol |
| SMILES | C#CC1OC12CCC1c3ccc(O)cc3CCC1C2 |
| InChI | InChI=1S/C17H18O2/c1-2-16-17(19-16)8-7-15-12(10-17)4-3-11-9-13(18)5-6-14(11)15/h1,5-6,9,12,15-16,18H,3-4,7-8,10H2 |
| InChIKey | QEBZRLUCINKMQX-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|