C19H21F3O2 — CID 102060275
(4bS,7S,8aS)-7-methyl-7-(4,4,4-trifluoro-1-hydroxybut-2-ynyl)-5,6,8,8a,9,10-hexahydro-4bH-phenanthren-2-ol (PubChem CID 102060275) has the molecular formula C19H21F3O2 and a molecular weight of 338.37 g/mol. Its IUPAC name is (4bS,7S,8aS)-7-methyl-7-(4,4,4-trifluoro-1-hydroxybut-2-ynyl)-5,6,8,8a,9,10-hexahydro-4bH-phenanthren-2-ol.
| Compound Name | (4bS,7S,8aS)-7-methyl-7-(4,4,4-trifluoro-1-hydroxybut-2-ynyl)-5,6,8,8a,9,10-hexahydro-4bH-phenanthren-2-ol |
|---|---|
| PubChem CID | 102060275 |
| Molecular Formula | C19H21F3O2 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | (4bS,7S,8aS)-7-methyl-7-(4,4,4-trifluoro-1-hydroxybut-2-ynyl)-5,6,8,8a,9,10-hexahydro-4bH-phenanthren-2-ol |
| SMILES | C[C@]1(C(O)C#CC(F)(F)F)CC[C@@H]2c3ccc(O)cc3CC[C@H]2C1 |
| InChI | InChI=1S/C19H21F3O2/c1-18(17(24)7-9-19(20,21)22)8-6-16-13(11-18)3-2-12-10-14(23)4-5-15(12)16/h4-5,10,13,16-17,23-24H,2-3,6,8,11H2,1H3/t13-,16-,17?,18-/m0/s1 |
| InChIKey | GCEHLIQGBSTENM-NDPYOVSOSA-N |
| XLogP | 4.16 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|