C16H14O3 — CID 15359812
(1R,9R)-17-oxatetracyclo[7.7.1.02,7.010,15]heptadeca-2(7),3,5,10(15),11,13-hexaene-5,13-diol (PubChem CID 15359812) has the molecular formula C16H14O3 and a molecular weight of 254.29 g/mol. Its IUPAC name is (1R,9R)-17-oxatetracyclo[7.7.1.02,7.010,15]heptadeca-2(7),3,5,10(15),11,13-hexaene-5,13-diol.
| Compound Name | (1R,9R)-17-oxatetracyclo[7.7.1.02,7.010,15]heptadeca-2(7),3,5,10(15),11,13-hexaene-5,13-diol |
|---|---|
| PubChem CID | 15359812 |
| Molecular Formula | C16H14O3 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | (1R,9R)-17-oxatetracyclo[7.7.1.02,7.010,15]heptadeca-2(7),3,5,10(15),11,13-hexaene-5,13-diol |
| SMILES | Oc1ccc2c(c1)C[C@H]1O[C@@H]2Cc2cc(O)ccc21 |
| InChI | InChI=1S/C16H14O3/c17-11-1-3-13-9(5-11)7-16-14-4-2-12(18)6-10(14)8-15(13)19-16/h1-6,15-18H,7-8H2/t15-,16-/m1/s1 |
| InChIKey | PKAATMULVKXHHV-HZPDHXFCSA-N |
| XLogP | 3.01 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |