C24H36N4S2 — CID 11125587
(4R,9R,18R,23R)-29,30-dithia-3,10,17,24-tetrazapentacyclo[24.2.1.112,15.04,9.018,23]triaconta-1(28),12,14,26-tetraene (PubChem CID 11125587) has the molecular formula C24H36N4S2 and a molecular weight of 444.71 g/mol. Its IUPAC name is (4R,9R,18R,23R)-29,30-dithia-3,10,17,24-tetrazapentacyclo[24.2.1.112,15.04,9.018,23]triaconta-1(28),12,14,26-tetraene.
| Compound Name | (4R,9R,18R,23R)-29,30-dithia-3,10,17,24-tetrazapentacyclo[24.2.1.112,15.04,9.018,23]triaconta-1(28),12,14,26-tetraene |
|---|---|
| PubChem CID | 11125587 |
| Molecular Formula | C24H36N4S2 |
| Molecular Weight | 444.71 g/mol |
| Exact Mass | 444.24 |
| IUPAC Name | (4R,9R,18R,23R)-29,30-dithia-3,10,17,24-tetrazapentacyclo[24.2.1.112,15.04,9.018,23]triaconta-1(28),12,14,26-tetraene |
| SMILES | c1cc2sc1CN[C@@H]1CCCC[C@H]1NCc1ccc(s1)CN[C@@H]1CCCC[C@H]1NC2 |
| InChI | InChI=1S/C24H36N4S2/c1-2-6-22-21(5-1)25-13-17-9-10-19(29-17)15-27-23-7-3-4-8-24(23)28-16-20-12-11-18(30-20)14-26-22/h9-12,21-28H,1-8,13-16H2/t21-,22-,23-,24-/m1/s1 |
| InChIKey | OKUHQBNEFGJVAP-MOUTVQLLSA-N |
| XLogP | 4.50 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.71 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |