C21H35N5 — CID 59897822
(14R,19R)-3,10,13,20,26-pentazatetracyclo[20.3.1.04,9.014,19]hexacosa-1(26),22,24-triene (PubChem CID 59897822) has the molecular formula C21H35N5 and a molecular weight of 357.55 g/mol. Its IUPAC name is (14R,19R)-3,10,13,20,26-pentazatetracyclo[20.3.1.04,9.014,19]hexacosa-1(26),22,24-triene.
| Compound Name | (14R,19R)-3,10,13,20,26-pentazatetracyclo[20.3.1.04,9.014,19]hexacosa-1(26),22,24-triene |
|---|---|
| PubChem CID | 59897822 |
| Molecular Formula | C21H35N5 |
| Molecular Weight | 357.55 g/mol |
| Exact Mass | 357.29 |
| IUPAC Name | (14R,19R)-3,10,13,20,26-pentazatetracyclo[20.3.1.04,9.014,19]hexacosa-1(26),22,24-triene |
| SMILES | c1cc2nc(c1)CN[C@@H]1CCCC[C@H]1NCCNC1CCCCC1NC2 |
| InChI | InChI=1S/C21H35N5/c1-3-10-20-18(8-1)22-12-13-23-19-9-2-4-11-21(19)25-15-17-7-5-6-16(26-17)14-24-20/h5-7,18-25H,1-4,8-15H2/t18-,19?,20-,21?/m1/s1 |
| InChIKey | MTQZSJFDXWEENV-NFYVFUGESA-N |
| XLogP | 2.08 |
| TPSA | 61.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.55 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |